C10H20O2 — CID 178009614
2-(2,3-dimethylbutyl)-1,4-dioxane (PubChem CID 178009614) has the molecular formula C10H20O2 and a molecular weight of 172.27 g/mol. Its IUPAC name is 2-(2,3-dimethylbutyl)-1,4-dioxane.
| Compound Name | 2-(2,3-dimethylbutyl)-1,4-dioxane |
|---|---|
| PubChem CID | 178009614 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | 2-(2,3-dimethylbutyl)-1,4-dioxane |
| SMILES | CC(C)C(C)CC1COCCO1 |
| InChI | InChI=1S/C10H20O2/c1-8(2)9(3)6-10-7-11-4-5-12-10/h8-10H,4-7H2,1-3H3 |
| InChIKey | DLWVTEOPSHTRDN-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |