C10H20O3 — CID 167458632
(2S)-2-[[(2S)-3-methylbutan-2-yl]oxymethyl]-1,4-dioxane (PubChem CID 167458632) has the molecular formula C10H20O3 and a molecular weight of 188.27 g/mol. Its IUPAC name is (2S)-2-[[(2S)-3-methylbutan-2-yl]oxymethyl]-1,4-dioxane.
| Compound Name | (2S)-2-[[(2S)-3-methylbutan-2-yl]oxymethyl]-1,4-dioxane |
|---|---|
| PubChem CID | 167458632 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | (2S)-2-[[(2S)-3-methylbutan-2-yl]oxymethyl]-1,4-dioxane |
| SMILES | CC(C)[C@H](C)OC[C@@H]1COCCO1 |
| InChI | InChI=1S/C10H20O3/c1-8(2)9(3)13-7-10-6-11-4-5-12-10/h8-10H,4-7H2,1-3H3/t9-,10-/m0/s1 |
| InChIKey | SLKPZOIHJULRMD-UWVGGRQHSA-N |
| XLogP | 1.46 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |