C8H16O3 — CID 167458864
(2S)-2-(propan-2-yloxymethyl)-1,4-dioxane (PubChem CID 167458864) has the molecular formula C8H16O3 and a molecular weight of 160.21 g/mol. Its IUPAC name is (2S)-2-(propan-2-yloxymethyl)-1,4-dioxane.
| Compound Name | (2S)-2-(propan-2-yloxymethyl)-1,4-dioxane |
|---|---|
| PubChem CID | 167458864 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | (2S)-2-(propan-2-yloxymethyl)-1,4-dioxane |
| SMILES | CC(C)OC[C@@H]1COCCO1 |
| InChI | InChI=1S/C8H16O3/c1-7(2)11-6-8-5-9-3-4-10-8/h7-8H,3-6H2,1-2H3/t8-/m0/s1 |
| InChIKey | AZRRTEBCAYMUIG-QMMMGPOBSA-N |
| XLogP | 0.83 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |