About 2-(1-chloroethenyl)-1,4-dioxane;hydron
2-(1-chloroethenyl)-1,4-dioxane;hydron (PubChem CID 174261802) has the molecular formula C6H10ClO2+
and a molecular weight of 149.60 g/mol. Its IUPAC name is 2-(1-chloroethenyl)-1,4-dioxane;hydron.
Molecular Properties
| Compound Name | 2-(1-chloroethenyl)-1,4-dioxane;hydron |
| PubChem CID | 174261802 |
| Molecular Formula | C6H10ClO2+ |
| Molecular Weight | 149.60 g/mol |
| Exact Mass | 149.04 |
| IUPAC Name | 2-(1-chloroethenyl)-1,4-dioxane;hydron |
| SMILES | C=C(Cl)C1COCCO1.[H+] |
| InChI | InChI=1S/C6H9ClO2/c1-5(7)6-4-8-2-3-9-6/h6H,1-4H2/p+1 |
| InChIKey | DAONOWQHFHEPGS-UHFFFAOYSA-O |
| XLogP | 1.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.60 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(1-chloroethenyl)-1,4-dioxane;hydron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-chloroethenyl)-1,4-dioxane;hydron?
The IUPAC name of 2-(1-chloroethenyl)-1,4-dioxane;hydron (CID 174261802) is 2-(1-chloroethenyl)-1,4-dioxane;hydron.
What is the SMILES notation for 2-(1-chloroethenyl)-1,4-dioxane;hydron?
The canonical SMILES for 2-(1-chloroethenyl)-1,4-dioxane;hydron is C=C(Cl)C1COCCO1.[H+].
What is the InChIKey of 2-(1-chloroethenyl)-1,4-dioxane;hydron?
The InChIKey is DAONOWQHFHEPGS-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H9ClO2/c1-5(7)6-4-8-2-3-9-6/h6H,1-4H2/p+1.
What are the key properties of 2-(1-chloroethenyl)-1,4-dioxane;hydron?
2-(1-chloroethenyl)-1,4-dioxane;hydron has a molecular weight of 149.60 g/mol, XLogP of 1.27, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-chloroethenyl)-1,4-dioxane;hydron is sourced from PubChem (CID 174261802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).