C6H14N4O2 — CID 126996388
1-amino-2-(1,4-dioxepan-6-yl)guanidine (PubChem CID 126996388) has the molecular formula C6H14N4O2 and a molecular weight of 174.20 g/mol. Its IUPAC name is 1-amino-2-(1,4-dioxepan-6-yl)guanidine.
| Compound Name | 1-amino-2-(1,4-dioxepan-6-yl)guanidine |
|---|---|
| PubChem CID | 126996388 |
| Molecular Formula | C6H14N4O2 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.11 |
| IUPAC Name | 1-amino-2-(1,4-dioxepan-6-yl)guanidine |
| SMILES | NN/C(N)=N/C1COCCOC1 |
| InChI | InChI=1S/C6H14N4O2/c7-6(10-8)9-5-3-11-1-2-12-4-5/h5H,1-4,8H2,(H3,7,9,10) |
| InChIKey | ADFBLIQXQKNHJS-UHFFFAOYSA-N |
| XLogP | -1.82 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|