C3H12N8 — CID 131852318
1-amino-2-[[(E)-[amino(hydrazinyl)methylidene]amino]methyl]guanidine (PubChem CID 131852318) has the molecular formula C3H12N8 and a molecular weight of 160.19 g/mol. Its IUPAC name is 1-amino-2-[[(E)-[amino(hydrazinyl)methylidene]amino]methyl]guanidine.
| Compound Name | 1-amino-2-[[(E)-[amino(hydrazinyl)methylidene]amino]methyl]guanidine |
|---|---|
| PubChem CID | 131852318 |
| Molecular Formula | C3H12N8 |
| Molecular Weight | 160.19 g/mol |
| Exact Mass | 160.12 |
| IUPAC Name | 1-amino-2-[[(E)-[amino(hydrazinyl)methylidene]amino]methyl]guanidine |
| SMILES | NN/C(N)=N/C/N=C(\N)NN |
| InChI | InChI=1S/C3H12N8/c4-2(10-6)8-1-9-3(5)11-7/h1,6-7H2,(H3,4,8,10)(H3,5,9,11) |
| InChIKey | JGMZOTHSWCQURH-UHFFFAOYSA-N |
| XLogP | -3.50 |
| TPSA | 152.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.19 |
| LogP ≤ 5 | -3.50 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|