C12H30N10 — CID 15052354
1-amino-2-[3-[4-[3-[[amino(hydrazinyl)methylidene]amino]propyl]piperazin-1-yl]propyl]guanidine (PubChem CID 15052354) has the molecular formula C12H30N10 and a molecular weight of 314.44 g/mol. Its IUPAC name is 1-amino-2-[3-[4-[3-[[amino(hydrazinyl)methylidene]amino]propyl]piperazin-1-yl]propyl]guanidine.
| Compound Name | 1-amino-2-[3-[4-[3-[[amino(hydrazinyl)methylidene]amino]propyl]piperazin-1-yl]propyl]guanidine |
|---|---|
| PubChem CID | 15052354 |
| Molecular Formula | C12H30N10 |
| Molecular Weight | 314.44 g/mol |
| Exact Mass | 314.27 |
| IUPAC Name | 1-amino-2-[3-[4-[3-[[amino(hydrazinyl)methylidene]amino]propyl]piperazin-1-yl]propyl]guanidine |
| SMILES | NN/C(N)=N/CCCN1CCN(CCC/N=C(\N)NN)CC1 |
| InChI | InChI=1S/C12H30N10/c13-11(19-15)17-3-1-5-21-7-9-22(10-8-21)6-2-4-18-12(14)20-16/h1-10,15-16H2,(H3,13,17,19)(H3,14,18,20) |
| InChIKey | LCLNOEUPXVNEQT-UHFFFAOYSA-N |
| XLogP | -3.06 |
| TPSA | 159.34 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.44 |
| LogP ≤ 5 | -3.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|