C10H23N5 — CID 95441677
2-[3-(4-ethylpiperazin-1-yl)propyl]guanidine (PubChem CID 95441677) has the molecular formula C10H23N5 and a molecular weight of 213.33 g/mol. Its IUPAC name is 2-[3-(4-ethylpiperazin-1-yl)propyl]guanidine.
| Compound Name | 2-[3-(4-ethylpiperazin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 95441677 |
| Molecular Formula | C10H23N5 |
| Molecular Weight | 213.33 g/mol |
| Exact Mass | 213.20 |
| IUPAC Name | 2-[3-(4-ethylpiperazin-1-yl)propyl]guanidine |
| SMILES | CCN1CCN(CCCN=C(N)N)CC1 |
| InChI | InChI=1S/C10H23N5/c1-2-14-6-8-15(9-7-14)5-3-4-13-10(11)12/h2-9H2,1H3,(H4,11,12,13) |
| InChIKey | XQEKAWIMZRESCK-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 70.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.33 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|