About (2R)-N-[(2S)-1-(2-fluorophenoxy)propan-2-yl]-1,4-dioxane-2-carboxamide
(2R)-N-[(2S)-1-(2-fluorophenoxy)propan-2-yl]-1,4-dioxane-2-carboxamide (PubChem CID 94198152) has the molecular formula C14H18FNO4
and a molecular weight of 283.30 g/mol. Its IUPAC name is (2R)-N-[(2S)-1-(2-fluorophenoxy)propan-2-yl]-1,4-dioxane-2-carboxamide.
Molecular Properties
| Compound Name | (2R)-N-[(2S)-1-(2-fluorophenoxy)propan-2-yl]-1,4-dioxane-2-carboxamide |
| PubChem CID | 94198152 |
| Molecular Formula | C14H18FNO4 |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | (2R)-N-[(2S)-1-(2-fluorophenoxy)propan-2-yl]-1,4-dioxane-2-carboxamide |
| SMILES | C[C@@H](COc1ccccc1F)NC(=O)[C@H]1COCCO1 |
| InChI | InChI=1S/C14H18FNO4/c1-10(8-20-12-5-3-2-4-11(12)15)16-14(17)13-9-18-6-7-19-13/h2-5,10,13H,6-9H2,1H3,(H,16,17)/t10-,13+/m0/s1 |
| InChIKey | AUCVAOGCLBZCTQ-GXFFZTMASA-N |
| XLogP | 1.12 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-N-[(2S)-1-(2-fluorophenoxy)propan-2-yl]-1,4-dioxane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N-[(2S)-1-(2-fluorophenoxy)propan-2-yl]-1,4-dioxane-2-carboxamide?
The IUPAC name of (2R)-N-[(2S)-1-(2-fluorophenoxy)propan-2-yl]-1,4-dioxane-2-carboxamide (CID 94198152) is (2R)-N-[(2S)-1-(2-fluorophenoxy)propan-2-yl]-1,4-dioxane-2-carboxamide.
What is the SMILES notation for (2R)-N-[(2S)-1-(2-fluorophenoxy)propan-2-yl]-1,4-dioxane-2-carboxamide?
The canonical SMILES for (2R)-N-[(2S)-1-(2-fluorophenoxy)propan-2-yl]-1,4-dioxane-2-carboxamide is C[C@@H](COc1ccccc1F)NC(=O)[C@H]1COCCO1.
What is the InChIKey of (2R)-N-[(2S)-1-(2-fluorophenoxy)propan-2-yl]-1,4-dioxane-2-carboxamide?
The InChIKey is AUCVAOGCLBZCTQ-GXFFZTMASA-N. The full InChI is InChI=1S/C14H18FNO4/c1-10(8-20-12-5-3-2-4-11(12)15)16-14(17)13-9-18-6-7-19-13/h2-5,10,13H,6-9H2,1H3,(H,16,17)/t10-,13+/m0/s1.
What are the key properties of (2R)-N-[(2S)-1-(2-fluorophenoxy)propan-2-yl]-1,4-dioxane-2-carboxamide?
(2R)-N-[(2S)-1-(2-fluorophenoxy)propan-2-yl]-1,4-dioxane-2-carboxamide has a molecular weight of 283.30 g/mol, XLogP of 1.12, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N-[(2S)-1-(2-fluorophenoxy)propan-2-yl]-1,4-dioxane-2-carboxamide is sourced from PubChem (CID 94198152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).