C16H23FN2O3 — CID 94594223
1-[(2S)-1-(2-fluorophenoxy)propan-2-yl]-3-(4-hydroxycyclohexyl)urea (PubChem CID 94594223) has the molecular formula C16H23FN2O3 and a molecular weight of 310.37 g/mol. Its IUPAC name is 1-[(2S)-1-(2-fluorophenoxy)propan-2-yl]-3-(4-hydroxycyclohexyl)urea.
| Compound Name | 1-[(2S)-1-(2-fluorophenoxy)propan-2-yl]-3-(4-hydroxycyclohexyl)urea |
|---|---|
| PubChem CID | 94594223 |
| Molecular Formula | C16H23FN2O3 |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 1-[(2S)-1-(2-fluorophenoxy)propan-2-yl]-3-(4-hydroxycyclohexyl)urea |
| SMILES | C[C@@H](COc1ccccc1F)NC(=O)NC1CCC(O)CC1 |
| InChI | InChI=1S/C16H23FN2O3/c1-11(10-22-15-5-3-2-4-14(15)17)18-16(21)19-12-6-8-13(20)9-7-12/h2-5,11-13,20H,6-10H2,1H3,(H2,18,19,21)/t11-,12?,13?/m0/s1 |
| InChIKey | IOACFGHHVVQVBW-HIFPTAJRSA-N |
| XLogP | 2.20 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |