C16H24N2O2 — CID 94192179
1-cyclohexyl-3-[(2S)-1-phenoxypropan-2-yl]urea (PubChem CID 94192179) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(2S)-1-phenoxypropan-2-yl]urea.
| Compound Name | 1-cyclohexyl-3-[(2S)-1-phenoxypropan-2-yl]urea |
|---|---|
| PubChem CID | 94192179 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 1-cyclohexyl-3-[(2S)-1-phenoxypropan-2-yl]urea |
| SMILES | C[C@@H](COc1ccccc1)NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C16H24N2O2/c1-13(12-20-15-10-6-3-7-11-15)17-16(19)18-14-8-4-2-5-9-14/h3,6-7,10-11,13-14H,2,4-5,8-9,12H2,1H3,(H2,17,18,19)/t13-/m0/s1 |
| InChIKey | IFRGQDQMKFIHHQ-ZDUSSCGKSA-N |
| XLogP | 3.09 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |