C27H38N2O3 — CID 163436088
1-cyclononyl-3-[(2S)-1-(3-methylphenoxy)-4-phenoxybutan-2-yl]urea (PubChem CID 163436088) has the molecular formula C27H38N2O3 and a molecular weight of 438.61 g/mol. Its IUPAC name is 1-cyclononyl-3-[(2S)-1-(3-methylphenoxy)-4-phenoxybutan-2-yl]urea.
| Compound Name | 1-cyclononyl-3-[(2S)-1-(3-methylphenoxy)-4-phenoxybutan-2-yl]urea |
|---|---|
| PubChem CID | 163436088 |
| Molecular Formula | C27H38N2O3 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.29 |
| IUPAC Name | 1-cyclononyl-3-[(2S)-1-(3-methylphenoxy)-4-phenoxybutan-2-yl]urea |
| SMILES | Cc1cccc(OC[C@H](CCOc2ccccc2)NC(=O)NC2CCCCCCCC2)c1 |
| InChI | InChI=1S/C27H38N2O3/c1-22-12-11-17-26(20-22)32-21-24(18-19-31-25-15-9-6-10-16-25)29-27(30)28-23-13-7-4-2-3-5-8-14-23/h6,9-12,15-17,20,23-24H,2-5,7-8,13-14,18-19,21H2,1H3,(H2,28,29,30)/t24-/m0/s1 |
| InChIKey | AUPNVABGHDCGLU-DEOSSOPVSA-N |
| XLogP | 6.01 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |