C16H20FN3O2 — CID 75374781
1-[1-(2-fluorophenoxy)propan-2-yl]-3-[(1-methylpyrrol-2-yl)methyl]urea (PubChem CID 75374781) has the molecular formula C16H20FN3O2 and a molecular weight of 305.35 g/mol. Its IUPAC name is 1-[1-(2-fluorophenoxy)propan-2-yl]-3-[(1-methylpyrrol-2-yl)methyl]urea.
| Compound Name | 1-[1-(2-fluorophenoxy)propan-2-yl]-3-[(1-methylpyrrol-2-yl)methyl]urea |
|---|---|
| PubChem CID | 75374781 |
| Molecular Formula | C16H20FN3O2 |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 1-[1-(2-fluorophenoxy)propan-2-yl]-3-[(1-methylpyrrol-2-yl)methyl]urea |
| SMILES | CC(COc1ccccc1F)NC(=O)NCc1cccn1C |
| InChI | InChI=1S/C16H20FN3O2/c1-12(11-22-15-8-4-3-7-14(15)17)19-16(21)18-10-13-6-5-9-20(13)2/h3-9,12H,10-11H2,1-2H3,(H2,18,19,21) |
| InChIKey | BBNBGOTYFQUDBM-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |