C16H25N3O2 — CID 96541637
1-[(2S)-1-anilinopropan-2-yl]-3-(4-hydroxycyclohexyl)urea (PubChem CID 96541637) has the molecular formula C16H25N3O2 and a molecular weight of 291.39 g/mol. Its IUPAC name is 1-[(2S)-1-anilinopropan-2-yl]-3-(4-hydroxycyclohexyl)urea.
| Compound Name | 1-[(2S)-1-anilinopropan-2-yl]-3-(4-hydroxycyclohexyl)urea |
|---|---|
| PubChem CID | 96541637 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 1-[(2S)-1-anilinopropan-2-yl]-3-(4-hydroxycyclohexyl)urea |
| SMILES | C[C@@H](CNc1ccccc1)NC(=O)NC1CCC(O)CC1 |
| InChI | InChI=1S/C16H25N3O2/c1-12(11-17-13-5-3-2-4-6-13)18-16(21)19-14-7-9-15(20)10-8-14/h2-6,12,14-15,17,20H,7-11H2,1H3,(H2,18,19,21)/t12-,14?,15?/m0/s1 |
| InChIKey | PZRPGNSIIJUWQN-GRTSSRMGSA-N |
| XLogP | 2.09 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |