C14H18N2O3 — CID 107843016
3-(2,3-dihydro-1H-inden-2-ylcarbamoylamino)butanoic acid (PubChem CID 107843016) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-inden-2-ylcarbamoylamino)butanoic acid.
| Compound Name | 3-(2,3-dihydro-1H-inden-2-ylcarbamoylamino)butanoic acid |
|---|---|
| PubChem CID | 107843016 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 3-(2,3-dihydro-1H-inden-2-ylcarbamoylamino)butanoic acid |
| SMILES | CC(CC(=O)O)NC(=O)NC1Cc2ccccc2C1 |
| InChI | InChI=1S/C14H18N2O3/c1-9(6-13(17)18)15-14(19)16-12-7-10-4-2-3-5-11(10)8-12/h2-5,9,12H,6-8H2,1H3,(H,17,18)(H2,15,16,19) |
| InChIKey | NBMUHLLAGPGCTD-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |