C13H16N2O3 — CID 114007977
3-(2,3-dihydro-1H-inden-2-ylcarbamoylamino)propanoic acid (PubChem CID 114007977) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-inden-2-ylcarbamoylamino)propanoic acid.
| Compound Name | 3-(2,3-dihydro-1H-inden-2-ylcarbamoylamino)propanoic acid |
|---|---|
| PubChem CID | 114007977 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 3-(2,3-dihydro-1H-inden-2-ylcarbamoylamino)propanoic acid |
| SMILES | O=C(O)CCNC(=O)NC1Cc2ccccc2C1 |
| InChI | InChI=1S/C13H16N2O3/c16-12(17)5-6-14-13(18)15-11-7-9-3-1-2-4-10(9)8-11/h1-4,11H,5-8H2,(H,16,17)(H2,14,15,18) |
| InChIKey | WDQISRPCXLIETR-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |