C16H18N2OS — CID 3496710
1-(2,3-dihydro-1H-inden-2-yl)-3-(2-thiophen-2-ylethyl)urea (PubChem CID 3496710) has the molecular formula C16H18N2OS and a molecular weight of 286.40 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-2-yl)-3-(2-thiophen-2-ylethyl)urea.
| Compound Name | 1-(2,3-dihydro-1H-inden-2-yl)-3-(2-thiophen-2-ylethyl)urea |
|---|---|
| PubChem CID | 3496710 |
| Molecular Formula | C16H18N2OS |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-2-yl)-3-(2-thiophen-2-ylethyl)urea |
| SMILES | O=C(NCCc1cccs1)NC1Cc2ccccc2C1 |
| InChI | InChI=1S/C16H18N2OS/c19-16(17-8-7-15-6-3-9-20-15)18-14-10-12-4-1-2-5-13(12)11-14/h1-6,9,14H,7-8,10-11H2,(H2,17,18,19) |
| InChIKey | ZXYUQNCBFAQSAC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |