C17H20N2OS — CID 51302009
1-(1,2,3,4-tetrahydronaphthalen-1-yl)-3-(2-thiophen-2-ylethyl)urea (PubChem CID 51302009) has the molecular formula C17H20N2OS and a molecular weight of 300.43 g/mol. Its IUPAC name is 1-(1,2,3,4-tetrahydronaphthalen-1-yl)-3-(2-thiophen-2-ylethyl)urea.
| Compound Name | 1-(1,2,3,4-tetrahydronaphthalen-1-yl)-3-(2-thiophen-2-ylethyl)urea |
|---|---|
| PubChem CID | 51302009 |
| Molecular Formula | C17H20N2OS |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 1-(1,2,3,4-tetrahydronaphthalen-1-yl)-3-(2-thiophen-2-ylethyl)urea |
| SMILES | O=C(NCCc1cccs1)NC1CCCc2ccccc21 |
| InChI | InChI=1S/C17H20N2OS/c20-17(18-11-10-14-7-4-12-21-14)19-16-9-3-6-13-5-1-2-8-15(13)16/h1-2,4-5,7-8,12,16H,3,6,9-11H2,(H2,18,19,20) |
| InChIKey | FDMCLVOBXWXCNL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |