C18H21FN2O2S — CID 125137586
1-[(2S,4S)-2-(4-fluorophenyl)oxan-4-yl]-3-(2-thiophen-2-ylethyl)urea (PubChem CID 125137586) has the molecular formula C18H21FN2O2S and a molecular weight of 348.44 g/mol. Its IUPAC name is 1-[(2S,4S)-2-(4-fluorophenyl)oxan-4-yl]-3-(2-thiophen-2-ylethyl)urea.
| Compound Name | 1-[(2S,4S)-2-(4-fluorophenyl)oxan-4-yl]-3-(2-thiophen-2-ylethyl)urea |
|---|---|
| PubChem CID | 125137586 |
| Molecular Formula | C18H21FN2O2S |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 1-[(2S,4S)-2-(4-fluorophenyl)oxan-4-yl]-3-(2-thiophen-2-ylethyl)urea |
| SMILES | O=C(NCCc1cccs1)N[C@H]1CCO[C@H](c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C18H21FN2O2S/c19-14-5-3-13(4-6-14)17-12-15(8-10-23-17)21-18(22)20-9-7-16-2-1-11-24-16/h1-6,11,15,17H,7-10,12H2,(H2,20,21,22)/t15-,17-/m0/s1 |
| InChIKey | YNIDYRRLHZYTJI-RDJZCZTQSA-N |
| XLogP | 3.65 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |