C19H25FN2O4 — CID 122009820
4-[[2-(4-fluorophenyl)oxan-4-yl]carbamoylamino]cyclohexane-1-carboxylic acid (PubChem CID 122009820) has the molecular formula C19H25FN2O4 and a molecular weight of 364.42 g/mol. Its IUPAC name is 4-[[2-(4-fluorophenyl)oxan-4-yl]carbamoylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[2-(4-fluorophenyl)oxan-4-yl]carbamoylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122009820 |
| Molecular Formula | C19H25FN2O4 |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 4-[[2-(4-fluorophenyl)oxan-4-yl]carbamoylamino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(NC1CCC(C(=O)O)CC1)NC1CCOC(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C19H25FN2O4/c20-14-5-1-12(2-6-14)17-11-16(9-10-26-17)22-19(25)21-15-7-3-13(4-8-15)18(23)24/h1-2,5-6,13,15-17H,3-4,7-11H2,(H,23,24)(H2,21,22,25) |
| InChIKey | RAHICVFVRZPJNE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |