C20H26N2O2 — CID 129429595
1-[(2S,4R)-2-phenyloxan-4-yl]-3-[(1S,2R,4S,5S)-3-tricyclo[3.2.1.02,4]octanyl]urea (PubChem CID 129429595) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is 1-[(2S,4R)-2-phenyloxan-4-yl]-3-[(1S,2R,4S,5S)-3-tricyclo[3.2.1.02,4]octanyl]urea.
| Compound Name | 1-[(2S,4R)-2-phenyloxan-4-yl]-3-[(1S,2R,4S,5S)-3-tricyclo[3.2.1.02,4]octanyl]urea |
|---|---|
| PubChem CID | 129429595 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 1-[(2S,4R)-2-phenyloxan-4-yl]-3-[(1S,2R,4S,5S)-3-tricyclo[3.2.1.02,4]octanyl]urea |
| SMILES | O=C(NC1[C@@H]2[C@H]3CC[C@@H](C3)[C@H]12)N[C@@H]1CCO[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C20H26N2O2/c23-20(22-19-17-13-6-7-14(10-13)18(17)19)21-15-8-9-24-16(11-15)12-4-2-1-3-5-12/h1-5,13-19H,6-11H2,(H2,21,22,23)/t13-,14-,15+,16-,17-,18+,19?/m0/s1 |
| InChIKey | WZZPBYUKBOFKIV-IWHBGJKCSA-N |
| XLogP | 3.25 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |