C17H27N3O2S — CID 16614679
4-(cyclohexylcarbamoylamino)-N-(2-thiophen-2-ylethyl)butanamide (PubChem CID 16614679) has the molecular formula C17H27N3O2S and a molecular weight of 337.49 g/mol. Its IUPAC name is 4-(cyclohexylcarbamoylamino)-N-(2-thiophen-2-ylethyl)butanamide.
| Compound Name | 4-(cyclohexylcarbamoylamino)-N-(2-thiophen-2-ylethyl)butanamide |
|---|---|
| PubChem CID | 16614679 |
| Molecular Formula | C17H27N3O2S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 4-(cyclohexylcarbamoylamino)-N-(2-thiophen-2-ylethyl)butanamide |
| SMILES | O=C(CCCNC(=O)NC1CCCCC1)NCCc1cccs1 |
| InChI | InChI=1S/C17H27N3O2S/c21-16(18-12-10-15-8-5-13-23-15)9-4-11-19-17(22)20-14-6-2-1-3-7-14/h5,8,13-14H,1-4,6-7,9-12H2,(H,18,21)(H2,19,20,22) |
| InChIKey | TXRVQYQCQJEKFO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|