C20H29N3O4 — CID 16614928
benzyl 2-[4-(cyclohexylcarbamoylamino)butanoylamino]acetate (PubChem CID 16614928) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is benzyl 2-[4-(cyclohexylcarbamoylamino)butanoylamino]acetate.
| Compound Name | benzyl 2-[4-(cyclohexylcarbamoylamino)butanoylamino]acetate |
|---|---|
| PubChem CID | 16614928 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | benzyl 2-[4-(cyclohexylcarbamoylamino)butanoylamino]acetate |
| SMILES | O=C(CCCNC(=O)NC1CCCCC1)NCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H29N3O4/c24-18(22-14-19(25)27-15-16-8-3-1-4-9-16)12-7-13-21-20(26)23-17-10-5-2-6-11-17/h1,3-4,8-9,17H,2,5-7,10-15H2,(H,22,24)(H2,21,23,26) |
| InChIKey | KAHFTCXSOWUKNR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|