C22H35N3O4 — CID 71063307
benzyl 2-[[2-(decylcarbamoylamino)acetyl]amino]acetate (PubChem CID 71063307) has the molecular formula C22H35N3O4 and a molecular weight of 405.54 g/mol. Its IUPAC name is benzyl 2-[[2-(decylcarbamoylamino)acetyl]amino]acetate.
| Compound Name | benzyl 2-[[2-(decylcarbamoylamino)acetyl]amino]acetate |
|---|---|
| PubChem CID | 71063307 |
| Molecular Formula | C22H35N3O4 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.26 |
| IUPAC Name | benzyl 2-[[2-(decylcarbamoylamino)acetyl]amino]acetate |
| SMILES | CCCCCCCCCCNC(=O)NCC(=O)NCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H35N3O4/c1-2-3-4-5-6-7-8-12-15-23-22(28)25-16-20(26)24-17-21(27)29-18-19-13-10-9-11-14-19/h9-11,13-14H,2-8,12,15-18H2,1H3,(H,24,26)(H2,23,25,28) |
| InChIKey | JODIAECKPBXOSI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|