C24H40N2O3 — CID 91350723
benzyl (2S)-2-(decylcarbamoylamino)-4-methylpentanoate (PubChem CID 91350723) has the molecular formula C24H40N2O3 and a molecular weight of 404.60 g/mol. Its IUPAC name is benzyl (2S)-2-(decylcarbamoylamino)-4-methylpentanoate.
| Compound Name | benzyl (2S)-2-(decylcarbamoylamino)-4-methylpentanoate |
|---|---|
| PubChem CID | 91350723 |
| Molecular Formula | C24H40N2O3 |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.30 |
| IUPAC Name | benzyl (2S)-2-(decylcarbamoylamino)-4-methylpentanoate |
| SMILES | CCCCCCCCCCNC(=O)N[C@@H](CC(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H40N2O3/c1-4-5-6-7-8-9-10-14-17-25-24(28)26-22(18-20(2)3)23(27)29-19-21-15-12-11-13-16-21/h11-13,15-16,20,22H,4-10,14,17-19H2,1-3H3,(H2,25,26,28)/t22-/m0/s1 |
| InChIKey | WXJKKXSIRFABQO-QFIPXVFZSA-N |
| XLogP | 5.58 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|