C19H27N3O4 — CID 119113414
2-[4-(cyclohexylcarbamoylamino)butanoylamino]-2-phenylacetic acid (PubChem CID 119113414) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is 2-[4-(cyclohexylcarbamoylamino)butanoylamino]-2-phenylacetic acid.
| Compound Name | 2-[4-(cyclohexylcarbamoylamino)butanoylamino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 119113414 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | 2-[4-(cyclohexylcarbamoylamino)butanoylamino]-2-phenylacetic acid |
| SMILES | O=C(CCCNC(=O)NC1CCCCC1)NC(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C19H27N3O4/c23-16(22-17(18(24)25)14-8-3-1-4-9-14)12-7-13-20-19(26)21-15-10-5-2-6-11-15/h1,3-4,8-9,15,17H,2,5-7,10-13H2,(H,22,23)(H,24,25)(H2,20,21,26) |
| InChIKey | FUSMSENHCHNCOK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|