C18H28N2O2 — CID 121112417
1-cyclohexyl-3-(5-hydroxy-3-phenylpentyl)urea (PubChem CID 121112417) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is 1-cyclohexyl-3-(5-hydroxy-3-phenylpentyl)urea.
| Compound Name | 1-cyclohexyl-3-(5-hydroxy-3-phenylpentyl)urea |
|---|---|
| PubChem CID | 121112417 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 1-cyclohexyl-3-(5-hydroxy-3-phenylpentyl)urea |
| SMILES | O=C(NCCC(CCO)c1ccccc1)NC1CCCCC1 |
| InChI | InChI=1S/C18H28N2O2/c21-14-12-16(15-7-3-1-4-8-15)11-13-19-18(22)20-17-9-5-2-6-10-17/h1,3-4,7-8,16-17,21H,2,5-6,9-14H2,(H2,19,20,22) |
| InChIKey | BSKVXWGKLQQAKN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |