C21H24N2O3 — CID 122010016
4-(2,3-dihydro-1H-inden-2-ylcarbamoylamino)-5-phenylpentanoic acid (PubChem CID 122010016) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is 4-(2,3-dihydro-1H-inden-2-ylcarbamoylamino)-5-phenylpentanoic acid.
| Compound Name | 4-(2,3-dihydro-1H-inden-2-ylcarbamoylamino)-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 122010016 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 4-(2,3-dihydro-1H-inden-2-ylcarbamoylamino)-5-phenylpentanoic acid |
| SMILES | O=C(O)CCC(Cc1ccccc1)NC(=O)NC1Cc2ccccc2C1 |
| InChI | InChI=1S/C21H24N2O3/c24-20(25)11-10-18(12-15-6-2-1-3-7-15)22-21(26)23-19-13-16-8-4-5-9-17(16)14-19/h1-9,18-19H,10-14H2,(H,24,25)(H2,22,23,26) |
| InChIKey | CTTORTBNYSDSKK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |