C22H27N3O4 — CID 122016696
5-phenyl-4-[[(2R,4R)-2-pyridin-2-yloxan-4-yl]carbamoylamino]pentanoic acid (PubChem CID 122016696) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is 5-phenyl-4-[[(2R,4R)-2-pyridin-2-yloxan-4-yl]carbamoylamino]pentanoic acid.
| Compound Name | 5-phenyl-4-[[(2R,4R)-2-pyridin-2-yloxan-4-yl]carbamoylamino]pentanoic acid |
|---|---|
| PubChem CID | 122016696 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 5-phenyl-4-[[(2R,4R)-2-pyridin-2-yloxan-4-yl]carbamoylamino]pentanoic acid |
| SMILES | O=C(O)CCC(Cc1ccccc1)NC(=O)N[C@@H]1CCO[C@@H](c2ccccn2)C1 |
| InChI | InChI=1S/C22H27N3O4/c26-21(27)10-9-17(14-16-6-2-1-3-7-16)24-22(28)25-18-11-13-29-20(15-18)19-8-4-5-12-23-19/h1-8,12,17-18,20H,9-11,13-15H2,(H,26,27)(H2,24,25,28)/t17?,18-,20-/m1/s1 |
| InChIKey | MTLCZTBWUPLHCW-PGDXBAMXSA-N |
| XLogP | 3.08 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |