C20H30N2O3S — CID 122016121
4-[[4-(methylsulfanylmethyl)cyclohexyl]carbamoylamino]-5-phenylpentanoic acid (PubChem CID 122016121) has the molecular formula C20H30N2O3S and a molecular weight of 378.54 g/mol. Its IUPAC name is 4-[[4-(methylsulfanylmethyl)cyclohexyl]carbamoylamino]-5-phenylpentanoic acid.
| Compound Name | 4-[[4-(methylsulfanylmethyl)cyclohexyl]carbamoylamino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 122016121 |
| Molecular Formula | C20H30N2O3S |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | 4-[[4-(methylsulfanylmethyl)cyclohexyl]carbamoylamino]-5-phenylpentanoic acid |
| SMILES | CSCC1CCC(NC(=O)NC(CCC(=O)O)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H30N2O3S/c1-26-14-16-7-9-17(10-8-16)21-20(25)22-18(11-12-19(23)24)13-15-5-3-2-4-6-15/h2-6,16-18H,7-14H2,1H3,(H,23,24)(H2,21,22,25) |
| InChIKey | GMEKXAHVRKHGJJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |