C18H23N3O3 — CID 122010045
4-[(2-cyanocyclopentyl)carbamoylamino]-5-phenylpentanoic acid (PubChem CID 122010045) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is 4-[(2-cyanocyclopentyl)carbamoylamino]-5-phenylpentanoic acid.
| Compound Name | 4-[(2-cyanocyclopentyl)carbamoylamino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 122010045 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 4-[(2-cyanocyclopentyl)carbamoylamino]-5-phenylpentanoic acid |
| SMILES | N#CC1CCCC1NC(=O)NC(CCC(=O)O)Cc1ccccc1 |
| InChI | InChI=1S/C18H23N3O3/c19-12-14-7-4-8-16(14)21-18(24)20-15(9-10-17(22)23)11-13-5-2-1-3-6-13/h1-3,5-6,14-16H,4,7-11H2,(H,22,23)(H2,20,21,24) |
| InChIKey | ZTHCIAJIGOYRCN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |