C20H28N2O4 — CID 122006783
4-(2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-ylcarbamoylamino)-5-phenylpentanoic acid (PubChem CID 122006783) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is 4-(2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-ylcarbamoylamino)-5-phenylpentanoic acid.
| Compound Name | 4-(2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-ylcarbamoylamino)-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 122006783 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 4-(2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-ylcarbamoylamino)-5-phenylpentanoic acid |
| SMILES | O=C(O)CCC(Cc1ccccc1)NC(=O)NC1CCCC2OCCC12 |
| InChI | InChI=1S/C20H28N2O4/c23-19(24)10-9-15(13-14-5-2-1-3-6-14)21-20(25)22-17-7-4-8-18-16(17)11-12-26-18/h1-3,5-6,15-18H,4,7-13H2,(H,23,24)(H2,21,22,25) |
| InChIKey | WSWJUPJYMHNWHK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |