C15H16N2O3 — CID 107843037
2-(2,3-dihydro-1H-inden-2-ylcarbamoylamino)pent-4-ynoic acid (PubChem CID 107843037) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-2-ylcarbamoylamino)pent-4-ynoic acid.
| Compound Name | 2-(2,3-dihydro-1H-inden-2-ylcarbamoylamino)pent-4-ynoic acid |
|---|---|
| PubChem CID | 107843037 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-2-ylcarbamoylamino)pent-4-ynoic acid |
| SMILES | C#CCC(NC(=O)NC1Cc2ccccc2C1)C(=O)O |
| InChI | InChI=1S/C15H16N2O3/c1-2-5-13(14(18)19)17-15(20)16-12-8-10-6-3-4-7-11(10)9-12/h1,3-4,6-7,12-13H,5,8-9H2,(H,18,19)(H2,16,17,20) |
| InChIKey | NMSOBWKKDQHXDX-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|