C12H22ClNO3 — CID 106355533
N-(1-chloro-4,4-dimethylpentan-3-yl)-1,4-dioxane-2-carboxamide (PubChem CID 106355533) has the molecular formula C12H22ClNO3 and a molecular weight of 263.76 g/mol. Its IUPAC name is N-(1-chloro-4,4-dimethylpentan-3-yl)-1,4-dioxane-2-carboxamide.
| Compound Name | N-(1-chloro-4,4-dimethylpentan-3-yl)-1,4-dioxane-2-carboxamide |
|---|---|
| PubChem CID | 106355533 |
| Molecular Formula | C12H22ClNO3 |
| Molecular Weight | 263.76 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | N-(1-chloro-4,4-dimethylpentan-3-yl)-1,4-dioxane-2-carboxamide |
| SMILES | CC(C)(C)C(CCCl)NC(=O)C1COCCO1 |
| InChI | InChI=1S/C12H22ClNO3/c1-12(2,3)10(4-5-13)14-11(15)9-8-16-6-7-17-9/h9-10H,4-8H2,1-3H3,(H,14,15) |
| InChIKey | VDYKHTTWNPRNGK-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.76 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|