C14H24ClF2NO — CID 114177886
N-(1-chloro-4,4-dimethylpentan-3-yl)-4,4-difluorocyclohexane-1-carboxamide (PubChem CID 114177886) has the molecular formula C14H24ClF2NO and a molecular weight of 295.80 g/mol. Its IUPAC name is N-(1-chloro-4,4-dimethylpentan-3-yl)-4,4-difluorocyclohexane-1-carboxamide.
| Compound Name | N-(1-chloro-4,4-dimethylpentan-3-yl)-4,4-difluorocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 114177886 |
| Molecular Formula | C14H24ClF2NO |
| Molecular Weight | 295.80 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | N-(1-chloro-4,4-dimethylpentan-3-yl)-4,4-difluorocyclohexane-1-carboxamide |
| SMILES | CC(C)(C)C(CCCl)NC(=O)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C14H24ClF2NO/c1-13(2,3)11(6-9-15)18-12(19)10-4-7-14(16,17)8-5-10/h10-11H,4-9H2,1-3H3,(H,18,19) |
| InChIKey | IJCNANMQGBLWDZ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.80 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|