C11H18ClF2NO — CID 83180012
N-(4-chlorobutan-2-yl)-4,4-difluorocyclohexane-1-carboxamide (PubChem CID 83180012) has the molecular formula C11H18ClF2NO and a molecular weight of 253.72 g/mol. Its IUPAC name is N-(4-chlorobutan-2-yl)-4,4-difluorocyclohexane-1-carboxamide.
| Compound Name | N-(4-chlorobutan-2-yl)-4,4-difluorocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 83180012 |
| Molecular Formula | C11H18ClF2NO |
| Molecular Weight | 253.72 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | N-(4-chlorobutan-2-yl)-4,4-difluorocyclohexane-1-carboxamide |
| SMILES | CC(CCCl)NC(=O)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C11H18ClF2NO/c1-8(4-7-12)15-10(16)9-2-5-11(13,14)6-3-9/h8-9H,2-7H2,1H3,(H,15,16) |
| InChIKey | XNXXMAOEQHGIJX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.72 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|