C13H19F2NO — CID 115774826
4,4-difluoro-N-hex-5-yn-3-ylcyclohexane-1-carboxamide (PubChem CID 115774826) has the molecular formula C13H19F2NO and a molecular weight of 243.30 g/mol. Its IUPAC name is 4,4-difluoro-N-hex-5-yn-3-ylcyclohexane-1-carboxamide.
| Compound Name | 4,4-difluoro-N-hex-5-yn-3-ylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 115774826 |
| Molecular Formula | C13H19F2NO |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 4,4-difluoro-N-hex-5-yn-3-ylcyclohexane-1-carboxamide |
| SMILES | C#CCC(CC)NC(=O)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C13H19F2NO/c1-3-5-11(4-2)16-12(17)10-6-8-13(14,15)9-7-10/h1,10-11H,4-9H2,2H3,(H,16,17) |
| InChIKey | JPAFZOSJCXPHQB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|