C15H18N2O — CID 113477452
N-hex-5-yn-3-yl-2,3-dihydro-1H-indole-2-carboxamide (PubChem CID 113477452) has the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. Its IUPAC name is N-hex-5-yn-3-yl-2,3-dihydro-1H-indole-2-carboxamide.
| Compound Name | N-hex-5-yn-3-yl-2,3-dihydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 113477452 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | N-hex-5-yn-3-yl-2,3-dihydro-1H-indole-2-carboxamide |
| SMILES | C#CCC(CC)NC(=O)C1Cc2ccccc2N1 |
| InChI | InChI=1S/C15H18N2O/c1-3-7-12(4-2)16-15(18)14-10-11-8-5-6-9-13(11)17-14/h1,5-6,8-9,12,14,17H,4,7,10H2,2H3,(H,16,18) |
| InChIKey | PCYUBTXWWHYQOO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|