C13H16N2O — CID 104864663
(2S)-N-but-3-en-2-yl-2,3-dihydro-1H-indole-2-carboxamide (PubChem CID 104864663) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is (2S)-N-but-3-en-2-yl-2,3-dihydro-1H-indole-2-carboxamide.
| Compound Name | (2S)-N-but-3-en-2-yl-2,3-dihydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 104864663 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | (2S)-N-but-3-en-2-yl-2,3-dihydro-1H-indole-2-carboxamide |
| SMILES | C=CC(C)NC(=O)[C@@H]1Cc2ccccc2N1 |
| InChI | InChI=1S/C13H16N2O/c1-3-9(2)14-13(16)12-8-10-6-4-5-7-11(10)15-12/h3-7,9,12,15H,1,8H2,2H3,(H,14,16)/t9?,12-/m0/s1 |
| InChIKey | LVAZQTVTWLEZGR-ACGXKRRESA-N |
| XLogP | 1.71 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|