C14H18N2O — CID 113466545
(2S)-N-pent-4-en-2-yl-2,3-dihydro-1H-indole-2-carboxamide (PubChem CID 113466545) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is (2S)-N-pent-4-en-2-yl-2,3-dihydro-1H-indole-2-carboxamide.
| Compound Name | (2S)-N-pent-4-en-2-yl-2,3-dihydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 113466545 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | (2S)-N-pent-4-en-2-yl-2,3-dihydro-1H-indole-2-carboxamide |
| SMILES | C=CCC(C)NC(=O)[C@@H]1Cc2ccccc2N1 |
| InChI | InChI=1S/C14H18N2O/c1-3-6-10(2)15-14(17)13-9-11-7-4-5-8-12(11)16-13/h3-5,7-8,10,13,16H,1,6,9H2,2H3,(H,15,17)/t10?,13-/m0/s1 |
| InChIKey | KQJSSWFJRFNEQB-HQVZTVAUSA-N |
| XLogP | 2.10 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|