C17H26N2O — CID 106025761
(2S)-N-octan-4-yl-2,3-dihydro-1H-indole-2-carboxamide (PubChem CID 106025761) has the molecular formula C17H26N2O and a molecular weight of 274.41 g/mol. Its IUPAC name is (2S)-N-octan-4-yl-2,3-dihydro-1H-indole-2-carboxamide.
| Compound Name | (2S)-N-octan-4-yl-2,3-dihydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 106025761 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | (2S)-N-octan-4-yl-2,3-dihydro-1H-indole-2-carboxamide |
| SMILES | CCCCC(CCC)NC(=O)[C@@H]1Cc2ccccc2N1 |
| InChI | InChI=1S/C17H26N2O/c1-3-5-10-14(8-4-2)18-17(20)16-12-13-9-6-7-11-15(13)19-16/h6-7,9,11,14,16,19H,3-5,8,10,12H2,1-2H3,(H,18,20)/t14?,16-/m0/s1 |
| InChIKey | CZOMCAGGXSTUCL-WMCAAGNKSA-N |
| XLogP | 3.50 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |