C16H20N2O — CID 106901728
N-hex-5-yn-3-yl-1,2,3,4-tetrahydroquinoline-3-carboxamide (PubChem CID 106901728) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is N-hex-5-yn-3-yl-1,2,3,4-tetrahydroquinoline-3-carboxamide.
| Compound Name | N-hex-5-yn-3-yl-1,2,3,4-tetrahydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 106901728 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | N-hex-5-yn-3-yl-1,2,3,4-tetrahydroquinoline-3-carboxamide |
| SMILES | C#CCC(CC)NC(=O)C1CNc2ccccc2C1 |
| InChI | InChI=1S/C16H20N2O/c1-3-7-14(4-2)18-16(19)13-10-12-8-5-6-9-15(12)17-11-13/h1,5-6,8-9,13-14,17H,4,7,10-11H2,2H3,(H,18,19) |
| InChIKey | VMEHSUHBACNLKG-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|