C14H18BrNO — CID 106894254
N-(1-bromobutan-2-yl)-2,3-dihydro-1H-indene-2-carboxamide (PubChem CID 106894254) has the molecular formula C14H18BrNO and a molecular weight of 296.21 g/mol. Its IUPAC name is N-(1-bromobutan-2-yl)-2,3-dihydro-1H-indene-2-carboxamide.
| Compound Name | N-(1-bromobutan-2-yl)-2,3-dihydro-1H-indene-2-carboxamide |
|---|---|
| PubChem CID | 106894254 |
| Molecular Formula | C14H18BrNO |
| Molecular Weight | 296.21 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | N-(1-bromobutan-2-yl)-2,3-dihydro-1H-indene-2-carboxamide |
| SMILES | CCC(CBr)NC(=O)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C14H18BrNO/c1-2-13(9-15)16-14(17)12-7-10-5-3-4-6-11(10)8-12/h3-6,12-13H,2,7-9H2,1H3,(H,16,17) |
| InChIKey | MUQRBUXBFAPJKT-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.21 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|