C16H19NO — CID 106703725
N-hex-5-yn-3-yl-2,3-dihydro-1H-indene-2-carboxamide (PubChem CID 106703725) has the molecular formula C16H19NO and a molecular weight of 241.33 g/mol. Its IUPAC name is N-hex-5-yn-3-yl-2,3-dihydro-1H-indene-2-carboxamide.
| Compound Name | N-hex-5-yn-3-yl-2,3-dihydro-1H-indene-2-carboxamide |
|---|---|
| PubChem CID | 106703725 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | N-hex-5-yn-3-yl-2,3-dihydro-1H-indene-2-carboxamide |
| SMILES | C#CCC(CC)NC(=O)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C16H19NO/c1-3-7-15(4-2)17-16(18)14-10-12-8-5-6-9-13(12)11-14/h1,5-6,8-9,14-15H,4,7,10-11H2,2H3,(H,17,18) |
| InChIKey | PDGUABWRQPFICR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|