About N-hex-5-yn-3-yl-2,3-dihydro-1H-indene-2-carboxamide
N-hex-5-yn-3-yl-2,3-dihydro-1H-indene-2-carboxamide (PubChem CID 106703725) has the molecular formula C16H19NO
and a molecular weight of 241.33 g/mol. Its IUPAC name is N-hex-5-yn-3-yl-2,3-dihydro-1H-indene-2-carboxamide.
Molecular Properties
| Compound Name | N-hex-5-yn-3-yl-2,3-dihydro-1H-indene-2-carboxamide |
| PubChem CID | 106703725 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | N-hex-5-yn-3-yl-2,3-dihydro-1H-indene-2-carboxamide |
| SMILES | C#CCC(CC)NC(=O)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C16H19NO/c1-3-7-15(4-2)17-16(18)14-10-12-8-5-6-9-13(12)11-14/h1,5-6,8-9,14-15H,4,7,10-11H2,2H3,(H,17,18) |
| InChIKey | PDGUABWRQPFICR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hex-5-yn-3-yl-2,3-dihydro-1H-indene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hex-5-yn-3-yl-2,3-dihydro-1H-indene-2-carboxamide?
The IUPAC name of N-hex-5-yn-3-yl-2,3-dihydro-1H-indene-2-carboxamide (CID 106703725) is N-hex-5-yn-3-yl-2,3-dihydro-1H-indene-2-carboxamide.
What is the SMILES notation for N-hex-5-yn-3-yl-2,3-dihydro-1H-indene-2-carboxamide?
The canonical SMILES for N-hex-5-yn-3-yl-2,3-dihydro-1H-indene-2-carboxamide is C#CCC(CC)NC(=O)C1Cc2ccccc2C1.
What is the InChIKey of N-hex-5-yn-3-yl-2,3-dihydro-1H-indene-2-carboxamide?
The InChIKey is PDGUABWRQPFICR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO/c1-3-7-15(4-2)17-16(18)14-10-12-8-5-6-9-13(12)11-14/h1,5-6,8-9,14-15H,4,7,10-11H2,2H3,(H,17,18).
What are the key properties of N-hex-5-yn-3-yl-2,3-dihydro-1H-indene-2-carboxamide?
N-hex-5-yn-3-yl-2,3-dihydro-1H-indene-2-carboxamide has a molecular weight of 241.33 g/mol, XLogP of 2.32, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-hex-5-yn-3-yl-2,3-dihydro-1H-indene-2-carboxamide is sourced from PubChem (CID 106703725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).