C13H19NO — CID 115647412
N-hex-5-yn-3-ylcyclohex-3-ene-1-carboxamide (PubChem CID 115647412) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is N-hex-5-yn-3-ylcyclohex-3-ene-1-carboxamide.
| Compound Name | N-hex-5-yn-3-ylcyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 115647412 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | N-hex-5-yn-3-ylcyclohex-3-ene-1-carboxamide |
| SMILES | C#CCC(CC)NC(=O)C1CC=CCC1 |
| InChI | InChI=1S/C13H19NO/c1-3-8-12(4-2)14-13(15)11-9-6-5-7-10-11/h1,5-6,11-12H,4,7-10H2,2H3,(H,14,15) |
| InChIKey | WSHZNCCQQJHVPH-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|