C15H18N2O — CID 106901779
N-pent-3-ynyl-1,2,3,4-tetrahydroquinoline-3-carboxamide (PubChem CID 106901779) has the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. Its IUPAC name is N-pent-3-ynyl-1,2,3,4-tetrahydroquinoline-3-carboxamide.
| Compound Name | N-pent-3-ynyl-1,2,3,4-tetrahydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 106901779 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | N-pent-3-ynyl-1,2,3,4-tetrahydroquinoline-3-carboxamide |
| SMILES | CC#CCCNC(=O)C1CNc2ccccc2C1 |
| InChI | InChI=1S/C15H18N2O/c1-2-3-6-9-16-15(18)13-10-12-7-4-5-8-14(12)17-11-13/h4-5,7-8,13,17H,6,9-11H2,1H3,(H,16,18) |
| InChIKey | YZRVATQPIBKWRL-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|