C15H19F3N2O — CID 115519993
N-(5,5,5-trifluoropentyl)-1,2,3,4-tetrahydroquinoline-3-carboxamide (PubChem CID 115519993) has the molecular formula C15H19F3N2O and a molecular weight of 300.32 g/mol. Its IUPAC name is N-(5,5,5-trifluoropentyl)-1,2,3,4-tetrahydroquinoline-3-carboxamide.
| Compound Name | N-(5,5,5-trifluoropentyl)-1,2,3,4-tetrahydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 115519993 |
| Molecular Formula | C15H19F3N2O |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | N-(5,5,5-trifluoropentyl)-1,2,3,4-tetrahydroquinoline-3-carboxamide |
| SMILES | O=C(NCCCCC(F)(F)F)C1CNc2ccccc2C1 |
| InChI | InChI=1S/C15H19F3N2O/c16-15(17,18)7-3-4-8-19-14(21)12-9-11-5-1-2-6-13(11)20-10-12/h1-2,5-6,12,20H,3-4,7-10H2,(H,19,21) |
| InChIKey | HJGOCCDCLJDNKE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|