C16H22N2O — CID 106901730
N-(2-cyclobutylethyl)-1,2,3,4-tetrahydroquinoline-3-carboxamide (PubChem CID 106901730) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is N-(2-cyclobutylethyl)-1,2,3,4-tetrahydroquinoline-3-carboxamide.
| Compound Name | N-(2-cyclobutylethyl)-1,2,3,4-tetrahydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 106901730 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | N-(2-cyclobutylethyl)-1,2,3,4-tetrahydroquinoline-3-carboxamide |
| SMILES | O=C(NCCC1CCC1)C1CNc2ccccc2C1 |
| InChI | InChI=1S/C16H22N2O/c19-16(17-9-8-12-4-3-5-12)14-10-13-6-1-2-7-15(13)18-11-14/h1-2,6-7,12,14,18H,3-5,8-11H2,(H,17,19) |
| InChIKey | JUWREIKDXRTWFI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |