C16H21F2NO3 — CID 86798519
N-[1-(3,4-dihydroxyphenyl)propan-2-yl]-4,4-difluorocyclohexane-1-carboxamide (PubChem CID 86798519) has the molecular formula C16H21F2NO3 and a molecular weight of 313.34 g/mol. Its IUPAC name is N-[1-(3,4-dihydroxyphenyl)propan-2-yl]-4,4-difluorocyclohexane-1-carboxamide.
| Compound Name | N-[1-(3,4-dihydroxyphenyl)propan-2-yl]-4,4-difluorocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 86798519 |
| Molecular Formula | C16H21F2NO3 |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | N-[1-(3,4-dihydroxyphenyl)propan-2-yl]-4,4-difluorocyclohexane-1-carboxamide |
| SMILES | CC(Cc1ccc(O)c(O)c1)NC(=O)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C16H21F2NO3/c1-10(8-11-2-3-13(20)14(21)9-11)19-15(22)12-4-6-16(17,18)7-5-12/h2-3,9-10,12,20-21H,4-8H2,1H3,(H,19,22) |
| InChIKey | RUTWUWJFPKQZIG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|