C16H20N2O4 — CID 86798513
N-[1-(3,4-dihydroxyphenyl)propan-2-yl]-5-propan-2-yl-1,2-oxazole-3-carboxamide (PubChem CID 86798513) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is N-[1-(3,4-dihydroxyphenyl)propan-2-yl]-5-propan-2-yl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[1-(3,4-dihydroxyphenyl)propan-2-yl]-5-propan-2-yl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 86798513 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | N-[1-(3,4-dihydroxyphenyl)propan-2-yl]-5-propan-2-yl-1,2-oxazole-3-carboxamide |
| SMILES | CC(Cc1ccc(O)c(O)c1)NC(=O)c1cc(C(C)C)on1 |
| InChI | InChI=1S/C16H20N2O4/c1-9(2)15-8-12(18-22-15)16(21)17-10(3)6-11-4-5-13(19)14(20)7-11/h4-5,7-10,19-20H,6H2,1-3H3,(H,17,21) |
| InChIKey | JIWBZVGMFRHSOY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|